About Maleylacetoacetate
Maleylacetoacetate (PubChem CID 6453754) has the molecular formula C8H6O5-
and a molecular weight of 182.13 g/mol.
Molecular Properties
| Compound Name | Maleylacetoacetate |
| PubChem CID | 6453754 |
| Molecular Formula | C8H6O5- |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | — |
| SMILES | O=[C]/C=C\C(=O)CC(=O)CC(=O)[O-] |
| InChI | InChI=1S/C8H7O5/c9-3-1-2-6(10)4-7(11)5-8(12)13/h1-2H,4-5H2,(H,12,13)/p-1/b2-1- |
| InChIKey | ARIWNCGEMAHEBN-UPHRSURJSA-M |
| XLogP | -1.68 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze Maleylacetoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Maleylacetoacetate?
The IUPAC name of Maleylacetoacetate (CID 6453754) is not available.
What is the SMILES notation for Maleylacetoacetate?
The canonical SMILES for Maleylacetoacetate is O=[C]/C=C\C(=O)CC(=O)CC(=O)[O-].
What is the InChIKey of Maleylacetoacetate?
The InChIKey is ARIWNCGEMAHEBN-UPHRSURJSA-M. The full InChI is InChI=1S/C8H7O5/c9-3-1-2-6(10)4-7(11)5-8(12)13/h1-2H,4-5H2,(H,12,13)/p-1/b2-1-.
What are the key properties of Maleylacetoacetate?
Maleylacetoacetate has a molecular weight of 182.13 g/mol, XLogP of -1.68, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Maleylacetoacetate is sourced from PubChem (CID 6453754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).