C12H19N3O2 — CID 64538101
N'-hydroxy-3-(1-hydroxypropan-2-ylamino)-2-phenylpropanimidamide (PubChem CID 64538101) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N'-hydroxy-3-(1-hydroxypropan-2-ylamino)-2-phenylpropanimidamide.
| Compound Name | N'-hydroxy-3-(1-hydroxypropan-2-ylamino)-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 64538101 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N'-hydroxy-3-(1-hydroxypropan-2-ylamino)-2-phenylpropanimidamide |
| SMILES | CC(CO)NCC(/C(N)=N/O)c1ccccc1 |
| InChI | InChI=1S/C12H19N3O2/c1-9(8-16)14-7-11(12(13)15-17)10-5-3-2-4-6-10/h2-6,9,11,14,16-17H,7-8H2,1H3,(H2,13,15) |
| InChIKey | FVJHKUXFUFQBDQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|