About 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol
2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol (PubChem CID 6453821) has the molecular formula C12H5Cl5O
and a molecular weight of 342.44 g/mol. Its IUPAC name is 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol.
Molecular Properties
| Compound Name | 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol |
| PubChem CID | 6453821 |
| Molecular Formula | C12H5Cl5O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 339.88 |
| IUPAC Name | 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol |
| SMILES | Oc1cc(Cl)c(-c2cc(Cl)c(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C12H5Cl5O/c13-7-3-10(16)9(15)1-5(7)6-2-11(17)12(18)4-8(6)14/h1-4,18H |
| InChIKey | AVHHNFHLLZCWFH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol?
The IUPAC name of 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol (CID 6453821) is 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol.
What is the SMILES notation for 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol?
The canonical SMILES for 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol is Oc1cc(Cl)c(-c2cc(Cl)c(Cl)cc2Cl)cc1Cl.
What is the InChIKey of 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol?
The InChIKey is AVHHNFHLLZCWFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Cl5O/c13-7-3-10(16)9(15)1-5(7)6-2-11(17)12(18)4-8(6)14/h1-4,18H.
What are the key properties of 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol?
2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol has a molecular weight of 342.44 g/mol, XLogP of 6.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-4-(2,4,5-trichlorophenyl)phenol is sourced from PubChem (CID 6453821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).