About 3,4,5-trichloro-2,6-difluoropyridine
3,4,5-trichloro-2,6-difluoropyridine (PubChem CID 6453828) has the molecular formula C5Cl3F2N
and a molecular weight of 218.42 g/mol. Its IUPAC name is 3,4,5-trichloro-2,6-difluoropyridine.
Molecular Properties
| Compound Name | 3,4,5-trichloro-2,6-difluoropyridine |
| PubChem CID | 6453828 |
| Molecular Formula | C5Cl3F2N |
| Molecular Weight | 218.42 g/mol |
| Exact Mass | 216.91 |
| IUPAC Name | 3,4,5-trichloro-2,6-difluoropyridine |
| SMILES | Fc1nc(F)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C5Cl3F2N/c6-1-2(7)4(9)11-5(10)3(1)8 |
| InChIKey | XOUHUCXTEKWSMO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5-trichloro-2,6-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trichloro-2,6-difluoropyridine?
The IUPAC name of 3,4,5-trichloro-2,6-difluoropyridine (CID 6453828) is 3,4,5-trichloro-2,6-difluoropyridine.
What is the SMILES notation for 3,4,5-trichloro-2,6-difluoropyridine?
The canonical SMILES for 3,4,5-trichloro-2,6-difluoropyridine is Fc1nc(F)c(Cl)c(Cl)c1Cl.
What is the InChIKey of 3,4,5-trichloro-2,6-difluoropyridine?
The InChIKey is XOUHUCXTEKWSMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5Cl3F2N/c6-1-2(7)4(9)11-5(10)3(1)8.
What are the key properties of 3,4,5-trichloro-2,6-difluoropyridine?
3,4,5-trichloro-2,6-difluoropyridine has a molecular weight of 218.42 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trichloro-2,6-difluoropyridine is sourced from PubChem (CID 6453828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).