C16H42O5Si6 — CID 6453921
ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 6453921) has the molecular formula C16H42O5Si6 and a molecular weight of 483.02 g/mol. Its IUPAC name is ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 6453921 |
| Molecular Formula | C16H42O5Si6 |
| Molecular Weight | 483.02 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane;2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)C=C.C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C8H24O4Si4.C8H18OSi2/c1-13(2)9-14(3,4)11-16(7,8)12-15(5,6)10-13;1-7-10(3,4)9-11(5,6)8-2/h1-8H3;7-8H,1-2H2,3-6H3 |
| InChIKey | OMHXNOYYZVLVEU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.02 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|