About 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole
3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole (PubChem CID 64539221) has the molecular formula C11H16F3N3O2
and a molecular weight of 279.26 g/mol. Its IUPAC name is 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole |
| PubChem CID | 64539221 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole |
| SMILES | CCOC(C)c1noc(C2(C(F)(F)F)CCNC2)n1 |
| InChI | InChI=1S/C11H16F3N3O2/c1-3-18-7(2)8-16-9(19-17-8)10(11(12,13)14)4-5-15-6-10/h7,15H,3-6H2,1-2H3 |
| InChIKey | KLRDLIUMTXMELY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole?
The IUPAC name of 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole (CID 64539221) is 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole.
What is the SMILES notation for 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole?
The canonical SMILES for 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole is CCOC(C)c1noc(C2(C(F)(F)F)CCNC2)n1.
What is the InChIKey of 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole?
The InChIKey is KLRDLIUMTXMELY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3O2/c1-3-18-7(2)8-16-9(19-17-8)10(11(12,13)14)4-5-15-6-10/h7,15H,3-6H2,1-2H3.
What are the key properties of 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole?
3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole has a molecular weight of 279.26 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethoxyethyl)-5-[3-(trifluoromethyl)pyrrolidin-3-yl]-1,2,4-oxadiazole is sourced from PubChem (CID 64539221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).