C18H31NO5 — CID 6453924
ethenyl acetate;2-ethylhexyl prop-2-enoate;prop-2-enamide (PubChem CID 6453924) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is ethenyl acetate;2-ethylhexyl prop-2-enoate;prop-2-enamide.
| Compound Name | ethenyl acetate;2-ethylhexyl prop-2-enoate;prop-2-enamide |
|---|---|
| PubChem CID | 6453924 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | ethenyl acetate;2-ethylhexyl prop-2-enoate;prop-2-enamide |
| SMILES | C=CC(=O)OCC(CC)CCCC.C=CC(N)=O.C=COC(C)=O |
| InChI | InChI=1S/C11H20O2.C4H6O2.C3H5NO/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-3-6-4(2)5;1-2-3(4)5/h6,10H,3-5,7-9H2,1-2H3;3H,1H2,2H3;2H,1H2,(H2,4,5) |
| InChIKey | AHLZICFMKIUANV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|