About disodium;benzene-1,3-diolate
disodium;benzene-1,3-diolate (PubChem CID 6453936) has the molecular formula C6H4Na2O2
and a molecular weight of 154.08 g/mol. Its IUPAC name is disodium;benzene-1,3-diolate.
Molecular Properties
| Compound Name | disodium;benzene-1,3-diolate |
| PubChem CID | 6453936 |
| Molecular Formula | C6H4Na2O2 |
| Molecular Weight | 154.08 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | disodium;benzene-1,3-diolate |
| SMILES | [Na+].[Na+].[O-]c1cccc([O-])c1 |
| InChI | InChI=1S/C6H6O2.2Na/c7-5-2-1-3-6(8)4-5;;/h1-4,7-8H;;/q;2*+1/p-2 |
| InChIKey | CHBGPSMCICHVTB-UHFFFAOYSA-L |
| XLogP | -6.16 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.08 |
| LogP ≤ 5 | -6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze disodium;benzene-1,3-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;benzene-1,3-diolate?
The IUPAC name of disodium;benzene-1,3-diolate (CID 6453936) is disodium;benzene-1,3-diolate.
What is the SMILES notation for disodium;benzene-1,3-diolate?
The canonical SMILES for disodium;benzene-1,3-diolate is [Na+].[Na+].[O-]c1cccc([O-])c1.
What is the InChIKey of disodium;benzene-1,3-diolate?
The InChIKey is CHBGPSMCICHVTB-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H6O2.2Na/c7-5-2-1-3-6(8)4-5;;/h1-4,7-8H;;/q;2*+1/p-2.
What are the key properties of disodium;benzene-1,3-diolate?
disodium;benzene-1,3-diolate has a molecular weight of 154.08 g/mol, XLogP of -6.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;benzene-1,3-diolate is sourced from PubChem (CID 6453936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).