C20H25NO7 — CID 6453945
[7-[(3,5-dimethyl-2-oxo-3H-furan-4-carbonyl)peroxymethyl]-2,3,5,8-tetrahydro-1H-pyrrolizin-1-yl] (E)-2-methylbut-2-enoate (PubChem CID 6453945) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is [7-[(3,5-dimethyl-2-oxo-3H-furan-4-carbonyl)peroxymethyl]-2,3,5,8-tetrahydro-1H-pyrrolizin-1-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [7-[(3,5-dimethyl-2-oxo-3H-furan-4-carbonyl)peroxymethyl]-2,3,5,8-tetrahydro-1H-pyrrolizin-1-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 6453945 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [7-[(3,5-dimethyl-2-oxo-3H-furan-4-carbonyl)peroxymethyl]-2,3,5,8-tetrahydro-1H-pyrrolizin-1-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC1CCN2CC=C(COOC(=O)C3=C(C)OC(=O)C3C)C12 |
| InChI | InChI=1S/C20H25NO7/c1-5-11(2)18(22)27-15-7-9-21-8-6-14(17(15)21)10-25-28-20(24)16-12(3)19(23)26-13(16)4/h5-6,12,15,17H,7-10H2,1-4H3/b11-5+ |
| InChIKey | ISIFDJDPTKJCQL-VZUCSPMQSA-N |
| XLogP | 1.82 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|