About (2R,3R)-2,3-dihydroxybutanal
(2R,3R)-2,3-dihydroxybutanal (PubChem CID 6453984) has the molecular formula C4H8O3
and a molecular weight of 104.10 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxybutanal.
Molecular Properties
| Compound Name | (2R,3R)-2,3-dihydroxybutanal |
| PubChem CID | 6453984 |
| Molecular Formula | C4H8O3 |
| Molecular Weight | 104.10 g/mol |
| Exact Mass | 104.05 |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanal |
| SMILES | C[C@@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C4H8O3/c1-3(6)4(7)2-5/h2-4,6-7H,1H3/t3-,4+/m1/s1 |
| InChIKey | DFFAMJFPVBTTBX-DMTCNVIQSA-N |
| XLogP | -1.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.10 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2,3-dihydroxybutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2,3-dihydroxybutanal?
The IUPAC name of (2R,3R)-2,3-dihydroxybutanal (CID 6453984) is (2R,3R)-2,3-dihydroxybutanal.
What is the SMILES notation for (2R,3R)-2,3-dihydroxybutanal?
The canonical SMILES for (2R,3R)-2,3-dihydroxybutanal is C[C@@H](O)[C@@H](O)C=O.
What is the InChIKey of (2R,3R)-2,3-dihydroxybutanal?
The InChIKey is DFFAMJFPVBTTBX-DMTCNVIQSA-N. The full InChI is InChI=1S/C4H8O3/c1-3(6)4(7)2-5/h2-4,6-7H,1H3/t3-,4+/m1/s1.
What are the key properties of (2R,3R)-2,3-dihydroxybutanal?
(2R,3R)-2,3-dihydroxybutanal has a molecular weight of 104.10 g/mol, XLogP of -1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2,3-dihydroxybutanal is sourced from PubChem (CID 6453984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).