About 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane
2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane (PubChem CID 6454029) has the molecular formula C14H16N2O4
and a molecular weight of 276.29 g/mol. Its IUPAC name is 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane.
Molecular Properties
| Compound Name | 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane |
| PubChem CID | 6454029 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane |
| SMILES | C1CO1.CC1CO1.Cc1ccc(N=C=O)cc1N=C=O |
| InChI | InChI=1S/C9H6N2O2.C3H6O.C2H4O/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;1-3-2-4-3;1-2-3-1/h2-4H,1H3;3H,2H2,1H3;1-2H2 |
| InChIKey | HLAOLBHNYWEARA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane?
The IUPAC name of 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane (CID 6454029) is 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane.
What is the SMILES notation for 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane?
The canonical SMILES for 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane is C1CO1.CC1CO1.Cc1ccc(N=C=O)cc1N=C=O.
What is the InChIKey of 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane?
The InChIKey is HLAOLBHNYWEARA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2.C3H6O.C2H4O/c1-7-2-3-8(10-5-12)4-9(7)11-6-13;1-3-2-4-3;1-2-3-1/h2-4H,1H3;3H,2H2,1H3;1-2H2.
What are the key properties of 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane?
2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane has a molecular weight of 276.29 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diisocyanato-1-methylbenzene;2-methyloxirane;oxirane is sourced from PubChem (CID 6454029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).