About 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one
3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one (PubChem CID 64540654) has the molecular formula C8H16N2O3
and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one |
| PubChem CID | 64540654 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one |
| SMILES | CC(O)C(N)CN1CCCOC1=O |
| InChI | InChI=1S/C8H16N2O3/c1-6(11)7(9)5-10-3-2-4-13-8(10)12/h6-7,11H,2-5,9H2,1H3 |
| InChIKey | SBRDTSJHLHORQC-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one?
The IUPAC name of 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one (CID 64540654) is 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one.
What is the SMILES notation for 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one?
The canonical SMILES for 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one is CC(O)C(N)CN1CCCOC1=O.
What is the InChIKey of 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one?
The InChIKey is SBRDTSJHLHORQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3/c1-6(11)7(9)5-10-3-2-4-13-8(10)12/h6-7,11H,2-5,9H2,1H3.
What are the key properties of 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one?
3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one has a molecular weight of 188.23 g/mol, XLogP of -0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-3-hydroxybutyl)-1,3-oxazinan-2-one is sourced from PubChem (CID 64540654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).