C13H22O6 — CID 6454083
(6S)-6-(methoxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 6454083) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (6S)-6-(methoxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (6S)-6-(methoxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 6454083 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (6S)-6-(methoxymethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | COC[C@@]12OCC3OC(C)(C)OC3C1OC(C)(C)O2 |
| InChI | InChI=1S/C13H22O6/c1-11(2)16-8-6-15-13(7-14-5)10(9(8)17-11)18-12(3,4)19-13/h8-10H,6-7H2,1-5H3/t8?,9?,10?,13-/m0/s1 |
| InChIKey | RLRIAKXKXXXWIV-HWMWNZGHSA-N |
| XLogP | 1.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |