C20H22N2O2 — CID 6454124
(3S,6S)-3,6-dibenzyl-1,4-dimethylpiperazine-2,5-dione (PubChem CID 6454124) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (3S,6S)-3,6-dibenzyl-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | (3S,6S)-3,6-dibenzyl-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 6454124 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (3S,6S)-3,6-dibenzyl-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CN1C(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O2/c1-21-17(13-15-9-5-3-6-10-15)20(24)22(2)18(19(21)23)14-16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | KNKXKVUFAHAVOL-ROUUACIJSA-N |
| XLogP | 2.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |