About 9H-carbazol-1-ol
9H-carbazol-1-ol (PubChem CID 6454228) has the molecular formula C12H9NO
and a molecular weight of 183.21 g/mol. Its IUPAC name is 9H-carbazol-1-ol.
Molecular Properties
| Compound Name | 9H-carbazol-1-ol |
| PubChem CID | 6454228 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 9H-carbazol-1-ol |
| SMILES | Oc1cccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9NO/c14-11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h1-7,13-14H |
| InChIKey | QBPAUIDFWFXLKB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-carbazol-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazol-1-ol?
The IUPAC name of 9H-carbazol-1-ol (CID 6454228) is 9H-carbazol-1-ol.
What is the SMILES notation for 9H-carbazol-1-ol?
The canonical SMILES for 9H-carbazol-1-ol is Oc1cccc2c1[nH]c1ccccc12.
What is the InChIKey of 9H-carbazol-1-ol?
The InChIKey is QBPAUIDFWFXLKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO/c14-11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h1-7,13-14H.
What are the key properties of 9H-carbazol-1-ol?
9H-carbazol-1-ol has a molecular weight of 183.21 g/mol, XLogP of 3.03, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazol-1-ol is sourced from PubChem (CID 6454228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).