C9H18N2O2S — CID 64542327
N-(2-amino-3-hydroxybutyl)thiolane-3-carboxamide (PubChem CID 64542327) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is N-(2-amino-3-hydroxybutyl)thiolane-3-carboxamide.
| Compound Name | N-(2-amino-3-hydroxybutyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 64542327 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-(2-amino-3-hydroxybutyl)thiolane-3-carboxamide |
| SMILES | CC(O)C(N)CNC(=O)C1CCSC1 |
| InChI | InChI=1S/C9H18N2O2S/c1-6(12)8(10)4-11-9(13)7-2-3-14-5-7/h6-8,12H,2-5,10H2,1H3,(H,11,13) |
| InChIKey | ZVPXWFIPXVFBST-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |