About 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol
1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol (PubChem CID 64542379) has the molecular formula C13H22N2OS
and a molecular weight of 254.40 g/mol. Its IUPAC name is 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol.
Molecular Properties
| Compound Name | 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol |
| PubChem CID | 64542379 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol |
| SMILES | CCC1CCCN(c2nc(C(C)O)cs2)CC1 |
| InChI | InChI=1S/C13H22N2OS/c1-3-11-5-4-7-15(8-6-11)13-14-12(9-17-13)10(2)16/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | OTOXTPBIHTVYOL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol?
The IUPAC name of 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol (CID 64542379) is 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol.
What is the SMILES notation for 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol?
The canonical SMILES for 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol is CCC1CCCN(c2nc(C(C)O)cs2)CC1.
What is the InChIKey of 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol?
The InChIKey is OTOXTPBIHTVYOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2OS/c1-3-11-5-4-7-15(8-6-11)13-14-12(9-17-13)10(2)16/h9-11,16H,3-8H2,1-2H3.
What are the key properties of 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol?
1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol has a molecular weight of 254.40 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-ethylazepan-1-yl)-1,3-thiazol-4-yl]ethanol is sourced from PubChem (CID 64542379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).