About butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate
butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate (PubChem CID 6454289) has the molecular formula C18H34O7Si
and a molecular weight of 390.55 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| PubChem CID | 6454289 |
| Molecular Formula | C18H34O7Si |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC.C=C(C)C(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C10H20O5Si.C8H14O2/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5;1-4-5-6-10-8(9)7(2)3/h1,6-8H2,2-5H3;2,4-6H2,1,3H3 |
| InChIKey | KARBZFAQMABQHH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
The IUPAC name of butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate (CID 6454289) is butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
What is the SMILES notation for butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
The canonical SMILES for butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCCC.C=C(C)C(=O)OCCC[Si](OC)(OC)OC.
What is the InChIKey of butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
The InChIKey is KARBZFAQMABQHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5Si.C8H14O2/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5;1-4-5-6-10-8(9)7(2)3/h1,6-8H2,2-5H3;2,4-6H2,1,3H3.
What are the key properties of butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate?
butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate has a molecular weight of 390.55 g/mol, XLogP of 3.28, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl 2-methylprop-2-enoate is sourced from PubChem (CID 6454289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).