About 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol
1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol (PubChem CID 64543111) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol |
| PubChem CID | 64543111 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol |
| SMILES | CC(O)c1csc(C2CC2)n1 |
| InChI | InChI=1S/C8H11NOS/c1-5(10)7-4-11-8(9-7)6-2-3-6/h4-6,10H,2-3H2,1H3 |
| InChIKey | HNLPYAMSZVGBFC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol?
The IUPAC name of 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol (CID 64543111) is 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol.
What is the SMILES notation for 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol?
The canonical SMILES for 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol is CC(O)c1csc(C2CC2)n1.
What is the InChIKey of 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol?
The InChIKey is HNLPYAMSZVGBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS/c1-5(10)7-4-11-8(9-7)6-2-3-6/h4-6,10H,2-3H2,1H3.
What are the key properties of 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol?
1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol has a molecular weight of 169.25 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclopropyl-1,3-thiazol-4-yl)ethanol is sourced from PubChem (CID 64543111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).