About 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane
8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane (PubChem CID 6454394) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 6454394 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CC1OC2(CCC(C(C)(C)C)CC2)OC1C |
| InChI | InChI=1S/C14H26O2/c1-10-11(2)16-14(15-10)8-6-12(7-9-14)13(3,4)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | RTRJMEYMKAXBNK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane (CID 6454394) is 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane is CC1OC2(CCC(C(C)(C)C)CC2)OC1C.
What is the InChIKey of 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane?
The InChIKey is RTRJMEYMKAXBNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-10-11(2)16-14(15-10)8-6-12(7-9-14)13(3,4)5/h10-12H,6-9H2,1-5H3.
What are the key properties of 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane?
8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane has a molecular weight of 226.36 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-2,3-dimethyl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 6454394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).