C10H16N2O2S — CID 64544241
1-[2-[3-methoxypropyl(methyl)amino]-1,3-thiazol-4-yl]ethanone (PubChem CID 64544241) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 1-[2-[3-methoxypropyl(methyl)amino]-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-[3-methoxypropyl(methyl)amino]-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 64544241 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-[2-[3-methoxypropyl(methyl)amino]-1,3-thiazol-4-yl]ethanone |
| SMILES | COCCCN(C)c1nc(C(C)=O)cs1 |
| InChI | InChI=1S/C10H16N2O2S/c1-8(13)9-7-15-10(11-9)12(2)5-4-6-14-3/h7H,4-6H2,1-3H3 |
| InChIKey | ZYOKNZSXBBZGCY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|