C36H36N8 — CID 6454438
bis[4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)phenyl]diazene (PubChem CID 6454438) has the molecular formula C36H36N8 and a molecular weight of 580.74 g/mol. Its IUPAC name is bis[4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)phenyl]diazene.
| Compound Name | bis[4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)phenyl]diazene |
|---|---|
| PubChem CID | 6454438 |
| Molecular Formula | C36H36N8 |
| Molecular Weight | 580.74 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | bis[4-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yldiazenyl)phenyl]diazene |
| SMILES | c1cc(/N=N/c2cc3c4c(c2)CCCN4CCC3)ccc1/N=N/c1ccc(/N=N/c2cc3c4c(c2)CCCN4CCC3)cc1 |
| InChI | InChI=1S/C36H36N8/c1-5-25-21-33(22-26-6-2-18-43(17-1)35(25)26)41-39-31-13-9-29(10-14-31)37-38-30-11-15-32(16-12-30)40-42-34-23-27-7-3-19-44-20-4-8-28(24-34)36(27)44/h9-16,21-24H,1-8,17-20H2/b38-37+,41-39+,42-40+ |
| InChIKey | GDKOEXXUQDZOLC-BVKFYPCPSA-N |
| XLogP | 10.33 |
| TPSA | 80.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.74 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|