C18H14N3O3S+ — CID 6454442
5-[(4-ethenylphenyl)sulfamoyl]-1-hydroxynaphthalene-2-diazonium (PubChem CID 6454442) has the molecular formula C18H14N3O3S+ and a molecular weight of 352.40 g/mol. Its IUPAC name is 5-[(4-ethenylphenyl)sulfamoyl]-1-hydroxynaphthalene-2-diazonium.
| Compound Name | 5-[(4-ethenylphenyl)sulfamoyl]-1-hydroxynaphthalene-2-diazonium |
|---|---|
| PubChem CID | 6454442 |
| Molecular Formula | C18H14N3O3S+ |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-[(4-ethenylphenyl)sulfamoyl]-1-hydroxynaphthalene-2-diazonium |
| SMILES | C=Cc1ccc(NS(=O)(=O)c2cccc3c(O)c([N+]#N)ccc23)cc1 |
| InChI | InChI=1S/C18H13N3O3S/c1-2-12-6-8-13(9-7-12)21-25(23,24)17-5-3-4-15-14(17)10-11-16(20-19)18(15)22/h2-11,21H,1H2/p+1 |
| InChIKey | XGPCGXZMYJWHTO-UHFFFAOYSA-O |
| XLogP | 4.47 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|