About 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine
5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine (PubChem CID 64544867) has the molecular formula C5H9N3OS
and a molecular weight of 159.21 g/mol. Its IUPAC name is 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine.
Molecular Properties
| Compound Name | 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine |
| PubChem CID | 64544867 |
| Molecular Formula | C5H9N3OS |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine |
| SMILES | CCOCc1nc(N)ns1 |
| InChI | InChI=1S/C5H9N3OS/c1-2-9-3-4-7-5(6)8-10-4/h2-3H2,1H3,(H2,6,8) |
| InChIKey | UKHDILBVFNDMEN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine?
The IUPAC name of 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine (CID 64544867) is 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine.
What is the SMILES notation for 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine?
The canonical SMILES for 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine is CCOCc1nc(N)ns1.
What is the InChIKey of 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine?
The InChIKey is UKHDILBVFNDMEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3OS/c1-2-9-3-4-7-5(6)8-10-4/h2-3H2,1H3,(H2,6,8).
What are the key properties of 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine?
5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine has a molecular weight of 159.21 g/mol, XLogP of 0.66, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethoxymethyl)-1,2,4-thiadiazol-3-amine is sourced from PubChem (CID 64544867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).