C14H18N2OS — CID 64545008
1-[2-(N,3,5-trimethylanilino)-1,3-thiazol-4-yl]ethanol (PubChem CID 64545008) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 1-[2-(N,3,5-trimethylanilino)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 1-[2-(N,3,5-trimethylanilino)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 64545008 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-[2-(N,3,5-trimethylanilino)-1,3-thiazol-4-yl]ethanol |
| SMILES | Cc1cc(C)cc(N(C)c2nc(C(C)O)cs2)c1 |
| InChI | InChI=1S/C14H18N2OS/c1-9-5-10(2)7-12(6-9)16(4)14-15-13(8-18-14)11(3)17/h5-8,11,17H,1-4H3 |
| InChIKey | MCJLXPLMJBXXEV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |