C5H9N3S — CID 64545491
4-(1-aminoethyl)-1,3-thiazol-2-amine (PubChem CID 64545491) has the molecular formula C5H9N3S and a molecular weight of 143.22 g/mol. Its IUPAC name is 4-(1-aminoethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1-aminoethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 64545491 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.22 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 4-(1-aminoethyl)-1,3-thiazol-2-amine |
| SMILES | CC(N)c1csc(N)n1 |
| InChI | InChI=1S/C5H9N3S/c1-3(6)4-2-9-5(7)8-4/h2-3H,6H2,1H3,(H2,7,8) |
| InChIKey | XHRDXPTWYNDGKL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |