About 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine
3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine (PubChem CID 6454576) has the molecular formula C13H18N2OS2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine |
| PubChem CID | 6454576 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine |
| SMILES | CC1CNCC(C)O1.S=c1[nH]c2ccccc2s1 |
| InChI | InChI=1S/C7H5NS2.C6H13NO/c9-7-8-5-3-1-2-4-6(5)10-7;1-5-3-7-4-6(2)8-5/h1-4H,(H,8,9);5-7H,3-4H2,1-2H3 |
| InChIKey | VWSHQXJQGDLFLX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine?
The IUPAC name of 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine (CID 6454576) is 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine.
What is the SMILES notation for 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine?
The canonical SMILES for 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine is CC1CNCC(C)O1.S=c1[nH]c2ccccc2s1.
What is the InChIKey of 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine?
The InChIKey is VWSHQXJQGDLFLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NS2.C6H13NO/c9-7-8-5-3-1-2-4-6(5)10-7;1-5-3-7-4-6(2)8-5/h1-4H,(H,8,9);5-7H,3-4H2,1-2H3.
What are the key properties of 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine?
3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine has a molecular weight of 282.43 g/mol, XLogP of 3.34, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-1,3-benzothiazole-2-thione;2,6-dimethylmorpholine is sourced from PubChem (CID 6454576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).