C15H20N4O2 — CID 64546458
N-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)propan-1-amine (PubChem CID 64546458) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)propan-1-amine.
| Compound Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 64546458 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-6-ylmethyl)-3-(1H-1,2,4-triazol-5-yl)propan-1-amine |
| SMILES | c1cc(CNCCCc2ncn[nH]2)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C15H20N4O2/c1-4-12(15-13(5-1)20-8-3-9-21-15)10-16-7-2-6-14-17-11-18-19-14/h1,4-5,11,16H,2-3,6-10H2,(H,17,18,19) |
| InChIKey | AZGWIRPBCFITSQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|