C12H11F3N4O2 — CID 64546842
N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide (PubChem CID 64546842) has the molecular formula C12H11F3N4O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 64546842 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCCc1ncn[nH]1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F3N4O2/c13-12(14,15)21-9-3-1-8(2-4-9)11(20)16-6-5-10-17-7-18-19-10/h1-4,7H,5-6H2,(H,16,20)(H,17,18,19) |
| InChIKey | XYASEPVBIHNSOM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |