C14H17BrN4 — CID 64547156
6-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 64547156) has the molecular formula C14H17BrN4 and a molecular weight of 321.22 g/mol. Its IUPAC name is 6-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 6-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 64547156 |
| Molecular Formula | C14H17BrN4 |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 6-bromo-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | Brc1ccc2c(c1)CCC(NCCc1ncn[nH]1)C2 |
| InChI | InChI=1S/C14H17BrN4/c15-12-3-1-11-8-13(4-2-10(11)7-12)16-6-5-14-17-9-18-19-14/h1,3,7,9,13,16H,2,4-6,8H2,(H,17,18,19) |
| InChIKey | GJRNFCKPYNSPFJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |