C16H27Cl2N5 — CID 6454726
N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine (PubChem CID 6454726) has the molecular formula C16H27Cl2N5 and a molecular weight of 360.33 g/mol. Its IUPAC name is N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 6454726 |
| Molecular Formula | C16H27Cl2N5 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
| SMILES | CCCCN(c1nc(Cl)nc(Cl)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C16H27Cl2N5/c1-6-7-8-23(14-20-12(17)19-13(18)21-14)11-9-15(2,3)22-16(4,5)10-11/h11,22H,6-10H2,1-5H3 |
| InChIKey | GFFYOTUTUOQYLA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |