About 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile
3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile (PubChem CID 6454748) has the molecular formula C14H6Br2I2N2O2
and a molecular weight of 647.83 g/mol. Its IUPAC name is 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile.
Molecular Properties
| Compound Name | 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile |
| PubChem CID | 6454748 |
| Molecular Formula | C14H6Br2I2N2O2 |
| Molecular Weight | 647.83 g/mol |
| Exact Mass | 645.69 |
| IUPAC Name | 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile |
| SMILES | N#Cc1cc(Br)c(O)c(Br)c1.N#Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C7H3Br2NO.C7H3I2NO/c2*8-5-1-4(3-10)2-6(9)7(5)11/h2*1-2,11H |
| InChIKey | AXWIHNFSZXSUPB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 647.83 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile?
The IUPAC name of 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile (CID 6454748) is 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile.
What is the SMILES notation for 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile?
The canonical SMILES for 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile is N#Cc1cc(Br)c(O)c(Br)c1.N#Cc1cc(I)c(O)c(I)c1.
What is the InChIKey of 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile?
The InChIKey is AXWIHNFSZXSUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Br2NO.C7H3I2NO/c2*8-5-1-4(3-10)2-6(9)7(5)11/h2*1-2,11H.
What are the key properties of 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile?
3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile has a molecular weight of 647.83 g/mol, XLogP of 5.26, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-4-hydroxybenzonitrile;4-hydroxy-3,5-diiodobenzonitrile is sourced from PubChem (CID 6454748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).