C10H19N5 — CID 64547694
1-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrrolidin-3-amine (PubChem CID 64547694) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 1-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrrolidin-3-amine.
| Compound Name | 1-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 64547694 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pyrrolidin-3-amine |
| SMILES | CN1CCC(NCCCc2ncn[nH]2)C1 |
| InChI | InChI=1S/C10H19N5/c1-15-6-4-9(7-15)11-5-2-3-10-12-8-13-14-10/h8-9,11H,2-7H2,1H3,(H,12,13,14) |
| InChIKey | ATQCOCFOZNSQBU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|