C14H17FN4OS — CID 64547717
3-(2-fluorophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide (PubChem CID 64547717) has the molecular formula C14H17FN4OS and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide.
| Compound Name | 3-(2-fluorophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide |
|---|---|
| PubChem CID | 64547717 |
| Molecular Formula | C14H17FN4OS |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-(2-fluorophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide |
| SMILES | O=C(CCSc1ccccc1F)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C14H17FN4OS/c15-11-4-1-2-5-12(11)21-9-7-14(20)16-8-3-6-13-17-10-18-19-13/h1-2,4-5,10H,3,6-9H2,(H,16,20)(H,17,18,19) |
| InChIKey | YIOKINPJOUXOKK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|