C10H12N6O3 — CID 64547861
2,4-dioxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1H-pyrimidine-5-carboxamide (PubChem CID 64547861) has the molecular formula C10H12N6O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2,4-dioxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1H-pyrimidine-5-carboxamide.
| Compound Name | 2,4-dioxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 64547861 |
| Molecular Formula | C10H12N6O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2,4-dioxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCCCc1ncn[nH]1)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12N6O3/c17-8(6-4-12-10(19)15-9(6)18)11-3-1-2-7-13-5-14-16-7/h4-5H,1-3H2,(H,11,17)(H,13,14,16)(H2,12,15,18,19) |
| InChIKey | KVHIRMHUVKTOEG-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|