C13H15FN4OS — CID 64548667
2-(2-fluorophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide (PubChem CID 64548667) has the molecular formula C13H15FN4OS and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
|---|---|
| PubChem CID | 64548667 |
| Molecular Formula | C13H15FN4OS |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]acetamide |
| SMILES | O=C(CSc1ccccc1F)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C13H15FN4OS/c14-10-4-1-2-5-11(10)20-8-13(19)15-7-3-6-12-16-9-17-18-12/h1-2,4-5,9H,3,6-8H2,(H,15,19)(H,16,17,18) |
| InChIKey | JTOBFSAZQVJJQU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|