C30H24ClN5 — CID 6454948
2-N,3-N,5-triphenylphenazin-5-ium-2,3,7-triamine chloride (PubChem CID 6454948) has the molecular formula C30H24ClN5 and a molecular weight of 490.01 g/mol. Its IUPAC name is 2-N,3-N,5-triphenylphenazin-5-ium-2,3,7-triamine chloride.
| Compound Name | 2-N,3-N,5-triphenylphenazin-5-ium-2,3,7-triamine chloride |
|---|---|
| PubChem CID | 6454948 |
| Molecular Formula | C30H24ClN5 |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 2-N,3-N,5-triphenylphenazin-5-ium-2,3,7-triamine chloride |
| SMILES | Nc1ccc2nc3cc(Nc4ccccc4)c(Nc4ccccc4)cc3[n+](-c3ccccc3)c2c1.[Cl-] |
| InChI | InChI=1S/C30H23N5.ClH/c31-21-16-17-25-29(18-21)35(24-14-8-3-9-15-24)30-20-27(33-23-12-6-2-7-13-23)26(19-28(30)34-25)32-22-10-4-1-5-11-22;/h1-20H,(H3,31,32,33,34);1H |
| InChIKey | SSPMWRJUTFVWHT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|