C12H22N2OS — CID 64550427
(1-amino-3-methylcyclohexyl)-thiomorpholin-4-ylmethanone (PubChem CID 64550427) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is (1-amino-3-methylcyclohexyl)-thiomorpholin-4-ylmethanone.
| Compound Name | (1-amino-3-methylcyclohexyl)-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 64550427 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (1-amino-3-methylcyclohexyl)-thiomorpholin-4-ylmethanone |
| SMILES | CC1CCCC(N)(C(=O)N2CCSCC2)C1 |
| InChI | InChI=1S/C12H22N2OS/c1-10-3-2-4-12(13,9-10)11(15)14-5-7-16-8-6-14/h10H,2-9,13H2,1H3 |
| InChIKey | RIQXSUSLPVITHY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |