C44H81NO4 — CID 6455047
N,N-dimethylcyclohexanamine;bis((9Z,12Z)-octadeca-9,12-dienoic acid) (PubChem CID 6455047) has the molecular formula C44H81NO4 and a molecular weight of 688.13 g/mol. Its IUPAC name is N,N-dimethylcyclohexanamine;bis((9Z,12Z)-octadeca-9,12-dienoic acid).
| Compound Name | N,N-dimethylcyclohexanamine;bis((9Z,12Z)-octadeca-9,12-dienoic acid) |
|---|---|
| PubChem CID | 6455047 |
| Molecular Formula | C44H81NO4 |
| Molecular Weight | 688.13 g/mol |
| Exact Mass | 687.62 |
| IUPAC Name | N,N-dimethylcyclohexanamine;bis((9Z,12Z)-octadeca-9,12-dienoic acid) |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.CN(C)C1CCCCC1 |
| InChI | InChI=1S/2C18H32O2.C8H17N/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-9(2)8-6-4-3-5-7-8/h2*6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);8H,3-7H2,1-2H3/b2*7-6-,10-9-; |
| InChIKey | PARXHLNSGGUEPJ-GRVYQHKQSA-N |
| XLogP | 13.65 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.13 |
| LogP ≤ 5 | 13.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|