About 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol
2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol (PubChem CID 64550587) has the molecular formula C8H16F3NO2
and a molecular weight of 215.21 g/mol. Its IUPAC name is 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol.
Molecular Properties
| Compound Name | 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol |
| PubChem CID | 64550587 |
| Molecular Formula | C8H16F3NO2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol |
| SMILES | CCC(C)(CO)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NO2/c1-3-7(2,5-13)12-4-6(14)8(9,10)11/h6,12-14H,3-5H2,1-2H3 |
| InChIKey | GKEGJYLOCLXGJS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
The IUPAC name of 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol (CID 64550587) is 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol.
What is the SMILES notation for 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
The canonical SMILES for 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol is CCC(C)(CO)NCC(O)C(F)(F)F.
What is the InChIKey of 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
The InChIKey is GKEGJYLOCLXGJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NO2/c1-3-7(2,5-13)12-4-6(14)8(9,10)11/h6,12-14H,3-5H2,1-2H3.
What are the key properties of 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol has a molecular weight of 215.21 g/mol, XLogP of 0.66, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol is sourced from PubChem (CID 64550587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).