About 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine
1,2-dihydropyridazine-3,6-dione;N-methylmethanamine (PubChem CID 6455141) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine.
Molecular Properties
| Compound Name | 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine |
| PubChem CID | 6455141 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine |
| SMILES | CNC.O=c1ccc(=O)[nH][nH]1 |
| InChI | InChI=1S/C4H4N2O2.C2H7N/c7-3-1-2-4(8)6-5-3;1-3-2/h1-2H,(H,5,7)(H,6,8);3H,1-2H3 |
| InChIKey | NFMHVAAEJHFZKV-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine?
The IUPAC name of 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine (CID 6455141) is 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine.
What is the SMILES notation for 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine?
The canonical SMILES for 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine is CNC.O=c1ccc(=O)[nH][nH]1.
What is the InChIKey of 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine?
The InChIKey is NFMHVAAEJHFZKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.C2H7N/c7-3-1-2-4(8)6-5-3;1-3-2/h1-2H,(H,5,7)(H,6,8);3H,1-2H3.
What are the key properties of 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine?
1,2-dihydropyridazine-3,6-dione;N-methylmethanamine has a molecular weight of 157.17 g/mol, XLogP of -1.10, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydropyridazine-3,6-dione;N-methylmethanamine is sourced from PubChem (CID 6455141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).