C17H25N3O — CID 64551877
1-amino-N-cyclopropyl-3-methyl-N-(pyridin-2-ylmethyl)cyclohexane-1-carboxamide (PubChem CID 64551877) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-amino-N-cyclopropyl-3-methyl-N-(pyridin-2-ylmethyl)cyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-cyclopropyl-3-methyl-N-(pyridin-2-ylmethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 64551877 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 1-amino-N-cyclopropyl-3-methyl-N-(pyridin-2-ylmethyl)cyclohexane-1-carboxamide |
| SMILES | CC1CCCC(N)(C(=O)N(Cc2ccccn2)C2CC2)C1 |
| InChI | InChI=1S/C17H25N3O/c1-13-5-4-9-17(18,11-13)16(21)20(15-7-8-15)12-14-6-2-3-10-19-14/h2-3,6,10,13,15H,4-5,7-9,11-12,18H2,1H3 |
| InChIKey | JYPROHPUPHQIBJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |