2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid

C8H10N2O4S2 — CID 64552395

IUPAC2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(NS(=O)(=O)C2CC2)n1
InChIInChI=1S/C8H10N2O4S2/c11-7(12)3-5-4-15-8(9-5)10-16(13,14)6-1-2-6/h4,6H,1-3H2,(H,9,10)(H,11,12)
InChIKeyBEGLKPSGKPZDEF-UHFFFAOYSA-N
MW262.31 g/mol
LogP0.67
Rot. Bonds5

About 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid

2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 64552395) has the molecular formula C8H10N2O4S2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid
PubChem CID64552395
Molecular FormulaC8H10N2O4S2
Molecular Weight262.31 g/mol
Exact Mass262.01
IUPAC Name2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(NS(=O)(=O)C2CC2)n1
InChIInChI=1S/C8H10N2O4S2/c11-7(12)3-5-4-15-8(9-5)10-16(13,14)6-1-2-6/h4,6H,1-3H2,(H,9,10)(H,11,12)
InChIKeyBEGLKPSGKPZDEF-UHFFFAOYSA-N
XLogP0.67
TPSA96.36 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.31
LogP ≤ 50.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid (CID 64552395) is 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1csc(NS(=O)(=O)C2CC2)n1.
What is the InChIKey of 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is BEGLKPSGKPZDEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4S2/c11-7(12)3-5-4-15-8(9-5)10-16(13,14)6-1-2-6/h4,6H,1-3H2,(H,9,10)(H,11,12).
What are the key properties of 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid?
2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 262.31 g/mol, XLogP of 0.67, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(cyclopropylsulfonylamino)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 64552395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).