About N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide
N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide (PubChem CID 64553354) has the molecular formula C8H17F3N2O2S
and a molecular weight of 262.30 g/mol. Its IUPAC name is N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide |
| PubChem CID | 64553354 |
| Molecular Formula | C8H17F3N2O2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide |
| SMILES | CC(C)(CNCCC(F)(F)F)NS(C)(=O)=O |
| InChI | InChI=1S/C8H17F3N2O2S/c1-7(2,13-16(3,14)15)6-12-5-4-8(9,10)11/h12-13H,4-6H2,1-3H3 |
| InChIKey | SMIGBMIRBFFGDH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide?
The IUPAC name of N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide (CID 64553354) is N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide?
The canonical SMILES for N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide is CC(C)(CNCCC(F)(F)F)NS(C)(=O)=O.
What is the InChIKey of N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide?
The InChIKey is SMIGBMIRBFFGDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F3N2O2S/c1-7(2,13-16(3,14)15)6-12-5-4-8(9,10)11/h12-13H,4-6H2,1-3H3.
What are the key properties of N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide?
N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide has a molecular weight of 262.30 g/mol, XLogP of 0.86, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-methyl-1-(3,3,3-trifluoropropylamino)propan-2-yl]methanesulfonamide is sourced from PubChem (CID 64553354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).