About 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride
2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride (PubChem CID 64553573) has the molecular formula C10H9ClF3NO5S
and a molecular weight of 347.70 g/mol. Its IUPAC name is 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride |
| PubChem CID | 64553573 |
| Molecular Formula | C10H9ClF3NO5S |
| Molecular Weight | 347.70 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride |
| SMILES | Cc1cc(OCCC(F)(F)F)c([N+](=O)[O-])cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H9ClF3NO5S/c1-6-4-8(20-3-2-10(12,13)14)7(15(16)17)5-9(6)21(11,18)19/h4-5H,2-3H2,1H3 |
| InChIKey | HYKPDMHTIJEIOE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride?
The IUPAC name of 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride (CID 64553573) is 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride.
What is the SMILES notation for 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride?
The canonical SMILES for 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride is Cc1cc(OCCC(F)(F)F)c([N+](=O)[O-])cc1S(=O)(=O)Cl.
What is the InChIKey of 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride?
The InChIKey is HYKPDMHTIJEIOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF3NO5S/c1-6-4-8(20-3-2-10(12,13)14)7(15(16)17)5-9(6)21(11,18)19/h4-5H,2-3H2,1H3.
What are the key properties of 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride?
2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride has a molecular weight of 347.70 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-nitro-4-(3,3,3-trifluoropropoxy)benzenesulfonyl chloride is sourced from PubChem (CID 64553573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).