About 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine
3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine (PubChem CID 64553638) has the molecular formula C12H21N3S
and a molecular weight of 239.39 g/mol. Its IUPAC name is 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine |
| PubChem CID | 64553638 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine |
| SMILES | CC1CCCC(N)(CNCc2cscn2)C1 |
| InChI | InChI=1S/C12H21N3S/c1-10-3-2-4-12(13,5-10)8-14-6-11-7-16-9-15-11/h7,9-10,14H,2-6,8,13H2,1H3 |
| InChIKey | NRLSWJXPBHPCRT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine?
The IUPAC name of 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine (CID 64553638) is 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine.
What is the SMILES notation for 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine?
The canonical SMILES for 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine is CC1CCCC(N)(CNCc2cscn2)C1.
What is the InChIKey of 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine?
The InChIKey is NRLSWJXPBHPCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3S/c1-10-3-2-4-12(13,5-10)8-14-6-11-7-16-9-15-11/h7,9-10,14H,2-6,8,13H2,1H3.
What are the key properties of 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine?
3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine has a molecular weight of 239.39 g/mol, XLogP of 2.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-[(1,3-thiazol-4-ylmethylamino)methyl]cyclohexan-1-amine is sourced from PubChem (CID 64553638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).