2-(3,3,3-trifluoropropylsulfanyl)propanoic acid

C6H9F3O2S — CID 64553934

IUPAC2-(3,3,3-trifluoropropylsulfanyl)propanoic acid
SMILESCC(SCCC(F)(F)F)C(=O)O
InChIInChI=1S/C6H9F3O2S/c1-4(5(10)11)12-3-2-6(7,8)9/h4H,2-3H2,1H3,(H,10,11)
InChIKeyRDGNPRPUIOWJBD-UHFFFAOYSA-N
MW202.20 g/mol
LogP2.15
Rot. Bonds4

About 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid

2-(3,3,3-trifluoropropylsulfanyl)propanoic acid (PubChem CID 64553934) has the molecular formula C6H9F3O2S and a molecular weight of 202.20 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid.

Molecular Properties

Compound Name2-(3,3,3-trifluoropropylsulfanyl)propanoic acid
PubChem CID64553934
Molecular FormulaC6H9F3O2S
Molecular Weight202.20 g/mol
Exact Mass202.03
IUPAC Name2-(3,3,3-trifluoropropylsulfanyl)propanoic acid
SMILESCC(SCCC(F)(F)F)C(=O)O
InChIInChI=1S/C6H9F3O2S/c1-4(5(10)11)12-3-2-6(7,8)9/h4H,2-3H2,1H3,(H,10,11)
InChIKeyRDGNPRPUIOWJBD-UHFFFAOYSA-N
XLogP2.15
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.20
LogP ≤ 52.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid?
The IUPAC name of 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid (CID 64553934) is 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid.
What is the SMILES notation for 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid?
The canonical SMILES for 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid is CC(SCCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid?
The InChIKey is RDGNPRPUIOWJBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3O2S/c1-4(5(10)11)12-3-2-6(7,8)9/h4H,2-3H2,1H3,(H,10,11).
What are the key properties of 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid?
2-(3,3,3-trifluoropropylsulfanyl)propanoic acid has a molecular weight of 202.20 g/mol, XLogP of 2.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3,3-trifluoropropylsulfanyl)propanoic acid is sourced from PubChem (CID 64553934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).