C9H7Br3F3N — CID 64554200
2,4,6-tribromo-N-(3,3,3-trifluoropropyl)aniline (PubChem CID 64554200) has the molecular formula C9H7Br3F3N and a molecular weight of 425.87 g/mol. Its IUPAC name is 2,4,6-tribromo-N-(3,3,3-trifluoropropyl)aniline.
| Compound Name | 2,4,6-tribromo-N-(3,3,3-trifluoropropyl)aniline |
|---|---|
| PubChem CID | 64554200 |
| Molecular Formula | C9H7Br3F3N |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 422.81 |
| IUPAC Name | 2,4,6-tribromo-N-(3,3,3-trifluoropropyl)aniline |
| SMILES | FC(F)(F)CCNc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C9H7Br3F3N/c10-5-3-6(11)8(7(12)4-5)16-2-1-9(13,14)15/h3-4,16H,1-2H2 |
| InChIKey | GYCHDGXLCPSIRE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |