About 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine
1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine (PubChem CID 64554463) has the molecular formula C12H24N2O2S
and a molecular weight of 260.40 g/mol. Its IUPAC name is 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine |
| PubChem CID | 64554463 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine |
| SMILES | CC1CCCC(N)(CN2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C12H24N2O2S/c1-11-3-2-4-12(13,9-11)10-14-5-7-17(15,16)8-6-14/h11H,2-10,13H2,1H3 |
| InChIKey | CJQYRPQMQJFKBP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine?
The IUPAC name of 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine (CID 64554463) is 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine.
What is the SMILES notation for 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine?
The canonical SMILES for 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine is CC1CCCC(N)(CN2CCS(=O)(=O)CC2)C1.
What is the InChIKey of 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine?
The InChIKey is CJQYRPQMQJFKBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2S/c1-11-3-2-4-12(13,9-11)10-14-5-7-17(15,16)8-6-14/h11H,2-10,13H2,1H3.
What are the key properties of 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine?
1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine has a molecular weight of 260.40 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-methylcyclohexan-1-amine is sourced from PubChem (CID 64554463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).