About triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane
triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane (PubChem CID 6455465) has the molecular formula C20H38O7Si
and a molecular weight of 418.60 g/mol. Its IUPAC name is triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane.
Molecular Properties
| Compound Name | triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane |
| PubChem CID | 6455465 |
| Molecular Formula | C20H38O7Si |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane |
| SMILES | C=CCOC(OCC=C)C(OCC=C)OCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C20H38O7Si/c1-7-14-21-19(22-15-8-2)20(23-16-9-3)24-17-13-18-28(25-10-4,26-11-5)27-12-6/h7-9,19-20H,1-3,10-18H2,4-6H3 |
| InChIKey | OJYVSVFMSBTURN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane?
The IUPAC name of triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane (CID 6455465) is triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane.
What is the SMILES notation for triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane?
The canonical SMILES for triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane is C=CCOC(OCC=C)C(OCC=C)OCCC[Si](OCC)(OCC)OCC.
What is the InChIKey of triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane?
The InChIKey is OJYVSVFMSBTURN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O7Si/c1-7-14-21-19(22-15-8-2)20(23-16-9-3)24-17-13-18-28(25-10-4,26-11-5)27-12-6/h7-9,19-20H,1-3,10-18H2,4-6H3.
What are the key properties of triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane?
triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane has a molecular weight of 418.60 g/mol, XLogP of 3.70, 21 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy-[3-[1,2,2-tris(prop-2-enoxy)ethoxy]propyl]silane is sourced from PubChem (CID 6455465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).